C27H29N3O5 — CID 121062645
N-[2-[[4-[(2-ethoxynaphthalene-1-carbonyl)amino]benzoyl]amino]ethyl]oxolane-2-carboxamide (PubChem CID 121062645) has the molecular formula C27H29N3O5 and a molecular weight of 475.55 g/mol. Its IUPAC name is N-[2-[[4-[(2-ethoxynaphthalene-1-carbonyl)amino]benzoyl]amino]ethyl]oxolane-2-carboxamide.
| Compound Name | N-[2-[[4-[(2-ethoxynaphthalene-1-carbonyl)amino]benzoyl]amino]ethyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 121062645 |
| Molecular Formula | C27H29N3O5 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | N-[2-[[4-[(2-ethoxynaphthalene-1-carbonyl)amino]benzoyl]amino]ethyl]oxolane-2-carboxamide |
| SMILES | CCOc1ccc2ccccc2c1C(=O)Nc1ccc(C(=O)NCCNC(=O)C2CCCO2)cc1 |
| InChI | InChI=1S/C27H29N3O5/c1-2-34-22-14-11-18-6-3-4-7-21(18)24(22)27(33)30-20-12-9-19(10-13-20)25(31)28-15-16-29-26(32)23-8-5-17-35-23/h3-4,6-7,9-14,23H,2,5,8,15-17H2,1H3,(H,28,31)(H,29,32)(H,30,33) |
| InChIKey | ZHYAKKXAQORFKC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|