C23H28N4O4 — CID 121062728
N-[2-[[4-[(2,3-dimethylphenyl)carbamoylamino]benzoyl]amino]ethyl]oxolane-2-carboxamide (PubChem CID 121062728) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is N-[2-[[4-[(2,3-dimethylphenyl)carbamoylamino]benzoyl]amino]ethyl]oxolane-2-carboxamide.
| Compound Name | N-[2-[[4-[(2,3-dimethylphenyl)carbamoylamino]benzoyl]amino]ethyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 121062728 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | N-[2-[[4-[(2,3-dimethylphenyl)carbamoylamino]benzoyl]amino]ethyl]oxolane-2-carboxamide |
| SMILES | Cc1cccc(NC(=O)Nc2ccc(C(=O)NCCNC(=O)C3CCCO3)cc2)c1C |
| InChI | InChI=1S/C23H28N4O4/c1-15-5-3-6-19(16(15)2)27-23(30)26-18-10-8-17(9-11-18)21(28)24-12-13-25-22(29)20-7-4-14-31-20/h3,5-6,8-11,20H,4,7,12-14H2,1-2H3,(H,24,28)(H,25,29)(H2,26,27,30) |
| InChIKey | SASCDLDJNPJCMB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|