C20H22N2O3 — CID 37396628
(2R)-N-[4-[(2,3-dimethylbenzoyl)amino]phenyl]oxolane-2-carboxamide (PubChem CID 37396628) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is (2R)-N-[4-[(2,3-dimethylbenzoyl)amino]phenyl]oxolane-2-carboxamide.
| Compound Name | (2R)-N-[4-[(2,3-dimethylbenzoyl)amino]phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 37396628 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | (2R)-N-[4-[(2,3-dimethylbenzoyl)amino]phenyl]oxolane-2-carboxamide |
| SMILES | Cc1cccc(C(=O)Nc2ccc(NC(=O)[C@H]3CCCO3)cc2)c1C |
| InChI | InChI=1S/C20H22N2O3/c1-13-5-3-6-17(14(13)2)19(23)21-15-8-10-16(11-9-15)22-20(24)18-7-4-12-25-18/h3,5-6,8-11,18H,4,7,12H2,1-2H3,(H,21,23)(H,22,24)/t18-/m1/s1 |
| InChIKey | SYKXPCSEGHCDJH-GOSISDBHSA-N |
| XLogP | 3.67 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |