C17H18N4O3 — CID 37396639
5-methyl-N-[4-[[(2S)-oxolane-2-carbonyl]amino]phenyl]pyrazine-2-carboxamide (PubChem CID 37396639) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is 5-methyl-N-[4-[[(2S)-oxolane-2-carbonyl]amino]phenyl]pyrazine-2-carboxamide.
| Compound Name | 5-methyl-N-[4-[[(2S)-oxolane-2-carbonyl]amino]phenyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 37396639 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 5-methyl-N-[4-[[(2S)-oxolane-2-carbonyl]amino]phenyl]pyrazine-2-carboxamide |
| SMILES | Cc1cnc(C(=O)Nc2ccc(NC(=O)[C@@H]3CCCO3)cc2)cn1 |
| InChI | InChI=1S/C17H18N4O3/c1-11-9-19-14(10-18-11)16(22)20-12-4-6-13(7-5-12)21-17(23)15-3-2-8-24-15/h4-7,9-10,15H,2-3,8H2,1H3,(H,20,22)(H,21,23)/t15-/m0/s1 |
| InChIKey | BKERNJHFXNDHCI-HNNXBMFYSA-N |
| XLogP | 2.15 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |