C22H26N4O5 — CID 121062718
N-[2-[[4-[(4-methoxyphenyl)carbamoylamino]benzoyl]amino]ethyl]oxolane-2-carboxamide (PubChem CID 121062718) has the molecular formula C22H26N4O5 and a molecular weight of 426.47 g/mol. Its IUPAC name is N-[2-[[4-[(4-methoxyphenyl)carbamoylamino]benzoyl]amino]ethyl]oxolane-2-carboxamide.
| Compound Name | N-[2-[[4-[(4-methoxyphenyl)carbamoylamino]benzoyl]amino]ethyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 121062718 |
| Molecular Formula | C22H26N4O5 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | N-[2-[[4-[(4-methoxyphenyl)carbamoylamino]benzoyl]amino]ethyl]oxolane-2-carboxamide |
| SMILES | COc1ccc(NC(=O)Nc2ccc(C(=O)NCCNC(=O)C3CCCO3)cc2)cc1 |
| InChI | InChI=1S/C22H26N4O5/c1-30-18-10-8-17(9-11-18)26-22(29)25-16-6-4-15(5-7-16)20(27)23-12-13-24-21(28)19-3-2-14-31-19/h4-11,19H,2-3,12-14H2,1H3,(H,23,27)(H,24,28)(H2,25,26,29) |
| InChIKey | MSNCDVGNPPXEFA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 117.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|