C15H20N2O4 — CID 42944644
N-[2-[(3-methoxybenzoyl)amino]ethyl]oxolane-2-carboxamide (PubChem CID 42944644) has the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. Its IUPAC name is N-[2-[(3-methoxybenzoyl)amino]ethyl]oxolane-2-carboxamide.
| Compound Name | N-[2-[(3-methoxybenzoyl)amino]ethyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 42944644 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | N-[2-[(3-methoxybenzoyl)amino]ethyl]oxolane-2-carboxamide |
| SMILES | COc1cccc(C(=O)NCCNC(=O)C2CCCO2)c1 |
| InChI | InChI=1S/C15H20N2O4/c1-20-12-5-2-4-11(10-12)14(18)16-7-8-17-15(19)13-6-3-9-21-13/h2,4-5,10,13H,3,6-9H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | IQOCQYOKBXTZMY-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|