C25H31N3O5 — CID 121062685
N-[2-[[4-[[2-(4-propan-2-ylphenoxy)acetyl]amino]benzoyl]amino]ethyl]oxolane-2-carboxamide (PubChem CID 121062685) has the molecular formula C25H31N3O5 and a molecular weight of 453.54 g/mol. Its IUPAC name is N-[2-[[4-[[2-(4-propan-2-ylphenoxy)acetyl]amino]benzoyl]amino]ethyl]oxolane-2-carboxamide.
| Compound Name | N-[2-[[4-[[2-(4-propan-2-ylphenoxy)acetyl]amino]benzoyl]amino]ethyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 121062685 |
| Molecular Formula | C25H31N3O5 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | N-[2-[[4-[[2-(4-propan-2-ylphenoxy)acetyl]amino]benzoyl]amino]ethyl]oxolane-2-carboxamide |
| SMILES | CC(C)c1ccc(OCC(=O)Nc2ccc(C(=O)NCCNC(=O)C3CCCO3)cc2)cc1 |
| InChI | InChI=1S/C25H31N3O5/c1-17(2)18-7-11-21(12-8-18)33-16-23(29)28-20-9-5-19(6-10-20)24(30)26-13-14-27-25(31)22-4-3-15-32-22/h5-12,17,22H,3-4,13-16H2,1-2H3,(H,26,30)(H,27,31)(H,28,29) |
| InChIKey | AACXXALJJOBTSS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|