C24H29NO4 — CID 2788654
cyclohexyl 4-[[2-(4-propan-2-ylphenoxy)acetyl]amino]benzoate (PubChem CID 2788654) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is cyclohexyl 4-[[2-(4-propan-2-ylphenoxy)acetyl]amino]benzoate.
| Compound Name | cyclohexyl 4-[[2-(4-propan-2-ylphenoxy)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 2788654 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | cyclohexyl 4-[[2-(4-propan-2-ylphenoxy)acetyl]amino]benzoate |
| SMILES | CC(C)c1ccc(OCC(=O)Nc2ccc(C(=O)OC3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C24H29NO4/c1-17(2)18-10-14-21(15-11-18)28-16-23(26)25-20-12-8-19(9-13-20)24(27)29-22-6-4-3-5-7-22/h8-15,17,22H,3-7,16H2,1-2H3,(H,25,26) |
| InChIKey | GBXRTKCMLDTEPF-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |