C27H35NO4 — CID 19237132
cyclohexyl 4-[4-(3-methyl-4-propan-2-ylphenoxy)butanoylamino]benzoate (PubChem CID 19237132) has the molecular formula C27H35NO4 and a molecular weight of 437.58 g/mol. Its IUPAC name is cyclohexyl 4-[4-(3-methyl-4-propan-2-ylphenoxy)butanoylamino]benzoate.
| Compound Name | cyclohexyl 4-[4-(3-methyl-4-propan-2-ylphenoxy)butanoylamino]benzoate |
|---|---|
| PubChem CID | 19237132 |
| Molecular Formula | C27H35NO4 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | cyclohexyl 4-[4-(3-methyl-4-propan-2-ylphenoxy)butanoylamino]benzoate |
| SMILES | Cc1cc(OCCCC(=O)Nc2ccc(C(=O)OC3CCCCC3)cc2)ccc1C(C)C |
| InChI | InChI=1S/C27H35NO4/c1-19(2)25-16-15-24(18-20(25)3)31-17-7-10-26(29)28-22-13-11-21(12-14-22)27(30)32-23-8-5-4-6-9-23/h11-16,18-19,23H,4-10,17H2,1-3H3,(H,28,29) |
| InChIKey | YYZHYMXNXZYKIU-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|