C27H31NO3 — CID 2072259
4-(3-methyl-4-propan-2-ylphenoxy)-N-(4-phenylmethoxyphenyl)butanamide (PubChem CID 2072259) has the molecular formula C27H31NO3 and a molecular weight of 417.55 g/mol. Its IUPAC name is 4-(3-methyl-4-propan-2-ylphenoxy)-N-(4-phenylmethoxyphenyl)butanamide.
| Compound Name | 4-(3-methyl-4-propan-2-ylphenoxy)-N-(4-phenylmethoxyphenyl)butanamide |
|---|---|
| PubChem CID | 2072259 |
| Molecular Formula | C27H31NO3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | 4-(3-methyl-4-propan-2-ylphenoxy)-N-(4-phenylmethoxyphenyl)butanamide |
| SMILES | Cc1cc(OCCCC(=O)Nc2ccc(OCc3ccccc3)cc2)ccc1C(C)C |
| InChI | InChI=1S/C27H31NO3/c1-20(2)26-16-15-25(18-21(26)3)30-17-7-10-27(29)28-23-11-13-24(14-12-23)31-19-22-8-5-4-6-9-22/h4-6,8-9,11-16,18,20H,7,10,17,19H2,1-3H3,(H,28,29) |
| InChIKey | XCTYDZTZGRGAMR-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|