C22H29NO2 — CID 2072237
N-(2,4-dimethylphenyl)-4-(3-methyl-4-propan-2-ylphenoxy)butanamide (PubChem CID 2072237) has the molecular formula C22H29NO2 and a molecular weight of 339.48 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-4-(3-methyl-4-propan-2-ylphenoxy)butanamide.
| Compound Name | N-(2,4-dimethylphenyl)-4-(3-methyl-4-propan-2-ylphenoxy)butanamide |
|---|---|
| PubChem CID | 2072237 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | N-(2,4-dimethylphenyl)-4-(3-methyl-4-propan-2-ylphenoxy)butanamide |
| SMILES | Cc1ccc(NC(=O)CCCOc2ccc(C(C)C)c(C)c2)c(C)c1 |
| InChI | InChI=1S/C22H29NO2/c1-15(2)20-10-9-19(14-17(20)4)25-12-6-7-22(24)23-21-11-8-16(3)13-18(21)5/h8-11,13-15H,6-7,12H2,1-5H3,(H,23,24) |
| InChIKey | JQFXBIXJQPTFNN-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|