C21H26O3 — CID 2072416
(3-methylphenyl) 4-(3-methyl-4-propan-2-ylphenoxy)butanoate (PubChem CID 2072416) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is (3-methylphenyl) 4-(3-methyl-4-propan-2-ylphenoxy)butanoate.
| Compound Name | (3-methylphenyl) 4-(3-methyl-4-propan-2-ylphenoxy)butanoate |
|---|---|
| PubChem CID | 2072416 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | (3-methylphenyl) 4-(3-methyl-4-propan-2-ylphenoxy)butanoate |
| SMILES | Cc1cccc(OC(=O)CCCOc2ccc(C(C)C)c(C)c2)c1 |
| InChI | InChI=1S/C21H26O3/c1-15(2)20-11-10-18(14-17(20)4)23-12-6-9-21(22)24-19-8-5-7-16(3)13-19/h5,7-8,10-11,13-15H,6,9,12H2,1-4H3 |
| InChIKey | KKLNHLPSSDIHEO-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|