C22H27ClO3 — CID 2072435
(4-chloro-3,5-dimethylphenyl) 4-(3-methyl-4-propan-2-ylphenoxy)butanoate (PubChem CID 2072435) has the molecular formula C22H27ClO3 and a molecular weight of 374.91 g/mol. Its IUPAC name is (4-chloro-3,5-dimethylphenyl) 4-(3-methyl-4-propan-2-ylphenoxy)butanoate.
| Compound Name | (4-chloro-3,5-dimethylphenyl) 4-(3-methyl-4-propan-2-ylphenoxy)butanoate |
|---|---|
| PubChem CID | 2072435 |
| Molecular Formula | C22H27ClO3 |
| Molecular Weight | 374.91 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | (4-chloro-3,5-dimethylphenyl) 4-(3-methyl-4-propan-2-ylphenoxy)butanoate |
| SMILES | Cc1cc(OCCCC(=O)Oc2cc(C)c(Cl)c(C)c2)ccc1C(C)C |
| InChI | InChI=1S/C22H27ClO3/c1-14(2)20-9-8-18(11-15(20)3)25-10-6-7-21(24)26-19-12-16(4)22(23)17(5)13-19/h8-9,11-14H,6-7,10H2,1-5H3 |
| InChIKey | DYLWSWPWUFPOAO-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.91 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|