About (4-ethylphenyl) 4-(3-methyl-4-propan-2-ylphenoxy)butanoate
(4-ethylphenyl) 4-(3-methyl-4-propan-2-ylphenoxy)butanoate (PubChem CID 2072421) has the molecular formula C22H28O3
and a molecular weight of 340.46 g/mol. Its IUPAC name is (4-ethylphenyl) 4-(3-methyl-4-propan-2-ylphenoxy)butanoate.
Molecular Properties
| Compound Name | (4-ethylphenyl) 4-(3-methyl-4-propan-2-ylphenoxy)butanoate |
| PubChem CID | 2072421 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | (4-ethylphenyl) 4-(3-methyl-4-propan-2-ylphenoxy)butanoate |
| SMILES | CCc1ccc(OC(=O)CCCOc2ccc(C(C)C)c(C)c2)cc1 |
| InChI | InChI=1S/C22H28O3/c1-5-18-8-10-19(11-9-18)25-22(23)7-6-14-24-20-12-13-21(16(2)3)17(4)15-20/h8-13,15-16H,5-7,14H2,1-4H3 |
| InChIKey | CLPIWXUJVCMROA-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-ethylphenyl) 4-(3-methyl-4-propan-2-ylphenoxy)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethylphenyl) 4-(3-methyl-4-propan-2-ylphenoxy)butanoate?
The IUPAC name of (4-ethylphenyl) 4-(3-methyl-4-propan-2-ylphenoxy)butanoate (CID 2072421) is (4-ethylphenyl) 4-(3-methyl-4-propan-2-ylphenoxy)butanoate.
What is the SMILES notation for (4-ethylphenyl) 4-(3-methyl-4-propan-2-ylphenoxy)butanoate?
The canonical SMILES for (4-ethylphenyl) 4-(3-methyl-4-propan-2-ylphenoxy)butanoate is CCc1ccc(OC(=O)CCCOc2ccc(C(C)C)c(C)c2)cc1.
What is the InChIKey of (4-ethylphenyl) 4-(3-methyl-4-propan-2-ylphenoxy)butanoate?
The InChIKey is CLPIWXUJVCMROA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28O3/c1-5-18-8-10-19(11-9-18)25-22(23)7-6-14-24-20-12-13-21(16(2)3)17(4)15-20/h8-13,15-16H,5-7,14H2,1-4H3.
What are the key properties of (4-ethylphenyl) 4-(3-methyl-4-propan-2-ylphenoxy)butanoate?
(4-ethylphenyl) 4-(3-methyl-4-propan-2-ylphenoxy)butanoate has a molecular weight of 340.46 g/mol, XLogP of 5.45, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethylphenyl) 4-(3-methyl-4-propan-2-ylphenoxy)butanoate is sourced from PubChem (CID 2072421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).