C18H22O2S — CID 43793596
4-(3-methyl-4-propan-2-ylphenoxy)-1-thiophen-2-ylbutan-1-one (PubChem CID 43793596) has the molecular formula C18H22O2S and a molecular weight of 302.44 g/mol. Its IUPAC name is 4-(3-methyl-4-propan-2-ylphenoxy)-1-thiophen-2-ylbutan-1-one.
| Compound Name | 4-(3-methyl-4-propan-2-ylphenoxy)-1-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 43793596 |
| Molecular Formula | C18H22O2S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 4-(3-methyl-4-propan-2-ylphenoxy)-1-thiophen-2-ylbutan-1-one |
| SMILES | Cc1cc(OCCCC(=O)c2cccs2)ccc1C(C)C |
| InChI | InChI=1S/C18H22O2S/c1-13(2)16-9-8-15(12-14(16)3)20-10-4-6-17(19)18-7-5-11-21-18/h5,7-9,11-13H,4,6,10H2,1-3H3 |
| InChIKey | DSZJIGFWXRVDTK-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|