C16H17ClO2S — CID 63567072
4-(4-chloro-2,6-dimethylphenoxy)-1-thiophen-2-ylbutan-1-one (PubChem CID 63567072) has the molecular formula C16H17ClO2S and a molecular weight of 308.83 g/mol. Its IUPAC name is 4-(4-chloro-2,6-dimethylphenoxy)-1-thiophen-2-ylbutan-1-one.
| Compound Name | 4-(4-chloro-2,6-dimethylphenoxy)-1-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 63567072 |
| Molecular Formula | C16H17ClO2S |
| Molecular Weight | 308.83 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 4-(4-chloro-2,6-dimethylphenoxy)-1-thiophen-2-ylbutan-1-one |
| SMILES | Cc1cc(Cl)cc(C)c1OCCCC(=O)c1cccs1 |
| InChI | InChI=1S/C16H17ClO2S/c1-11-9-13(17)10-12(2)16(11)19-7-3-5-14(18)15-6-4-8-20-15/h4,6,8-10H,3,5,7H2,1-2H3 |
| InChIKey | PSANNLJCJORCOI-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.83 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|