C14H12Cl2O2S — CID 60656845
4-(2,3-dichlorophenoxy)-1-thiophen-2-ylbutan-1-one (PubChem CID 60656845) has the molecular formula C14H12Cl2O2S and a molecular weight of 315.22 g/mol. Its IUPAC name is 4-(2,3-dichlorophenoxy)-1-thiophen-2-ylbutan-1-one.
| Compound Name | 4-(2,3-dichlorophenoxy)-1-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 60656845 |
| Molecular Formula | C14H12Cl2O2S |
| Molecular Weight | 315.22 g/mol |
| Exact Mass | 313.99 |
| IUPAC Name | 4-(2,3-dichlorophenoxy)-1-thiophen-2-ylbutan-1-one |
| SMILES | O=C(CCCOc1cccc(Cl)c1Cl)c1cccs1 |
| InChI | InChI=1S/C14H12Cl2O2S/c15-10-4-1-6-12(14(10)16)18-8-2-5-11(17)13-7-3-9-19-13/h1,3-4,6-7,9H,2,5,8H2 |
| InChIKey | VAHZIJNULCACOX-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.22 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|