C14H11Cl3O2S — CID 60625178
1-thiophen-2-yl-4-(2,4,5-trichlorophenoxy)butan-1-one (PubChem CID 60625178) has the molecular formula C14H11Cl3O2S and a molecular weight of 349.67 g/mol. Its IUPAC name is 1-thiophen-2-yl-4-(2,4,5-trichlorophenoxy)butan-1-one.
| Compound Name | 1-thiophen-2-yl-4-(2,4,5-trichlorophenoxy)butan-1-one |
|---|---|
| PubChem CID | 60625178 |
| Molecular Formula | C14H11Cl3O2S |
| Molecular Weight | 349.67 g/mol |
| Exact Mass | 347.95 |
| IUPAC Name | 1-thiophen-2-yl-4-(2,4,5-trichlorophenoxy)butan-1-one |
| SMILES | O=C(CCCOc1cc(Cl)c(Cl)cc1Cl)c1cccs1 |
| InChI | InChI=1S/C14H11Cl3O2S/c15-9-7-11(17)13(8-10(9)16)19-5-1-3-12(18)14-4-2-6-20-14/h2,4,6-8H,1,3,5H2 |
| InChIKey | LGWAMUIVRNALKF-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.67 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|