C15H15FO2S — CID 107659455
4-(2-fluoro-3-methylphenoxy)-1-thiophen-2-ylbutan-1-one (PubChem CID 107659455) has the molecular formula C15H15FO2S and a molecular weight of 278.35 g/mol. Its IUPAC name is 4-(2-fluoro-3-methylphenoxy)-1-thiophen-2-ylbutan-1-one.
| Compound Name | 4-(2-fluoro-3-methylphenoxy)-1-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 107659455 |
| Molecular Formula | C15H15FO2S |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 4-(2-fluoro-3-methylphenoxy)-1-thiophen-2-ylbutan-1-one |
| SMILES | Cc1cccc(OCCCC(=O)c2cccs2)c1F |
| InChI | InChI=1S/C15H15FO2S/c1-11-5-2-7-13(15(11)16)18-9-3-6-12(17)14-8-4-10-19-14/h2,4-5,7-8,10H,3,6,9H2,1H3 |
| InChIKey | JVTJPZHHHKEBHK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|