C16H17NO3S — CID 62030071
N-[3-(4-oxo-4-thiophen-2-ylbutoxy)phenyl]acetamide (PubChem CID 62030071) has the molecular formula C16H17NO3S and a molecular weight of 303.38 g/mol. Its IUPAC name is N-[3-(4-oxo-4-thiophen-2-ylbutoxy)phenyl]acetamide.
| Compound Name | N-[3-(4-oxo-4-thiophen-2-ylbutoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 62030071 |
| Molecular Formula | C16H17NO3S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | N-[3-(4-oxo-4-thiophen-2-ylbutoxy)phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(OCCCC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C16H17NO3S/c1-12(18)17-13-5-2-6-14(11-13)20-9-3-7-15(19)16-8-4-10-21-16/h2,4-6,8,10-11H,3,7,9H2,1H3,(H,17,18) |
| InChIKey | LBLLDMKJBQMIJC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|