C15H15NO3S — CID 62031014
4-(4-oxo-4-thiophen-2-ylbutoxy)benzamide (PubChem CID 62031014) has the molecular formula C15H15NO3S and a molecular weight of 289.36 g/mol. Its IUPAC name is 4-(4-oxo-4-thiophen-2-ylbutoxy)benzamide.
| Compound Name | 4-(4-oxo-4-thiophen-2-ylbutoxy)benzamide |
|---|---|
| PubChem CID | 62031014 |
| Molecular Formula | C15H15NO3S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 4-(4-oxo-4-thiophen-2-ylbutoxy)benzamide |
| SMILES | NC(=O)c1ccc(OCCCC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C15H15NO3S/c16-15(18)11-5-7-12(8-6-11)19-9-1-3-13(17)14-4-2-10-20-14/h2,4-8,10H,1,3,9H2,(H2,16,18) |
| InChIKey | AOMLCLQYLGZOBI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|