C15H16O4S2 — CID 43807175
4-(3-methylsulfonylphenoxy)-1-thiophen-2-ylbutan-1-one (PubChem CID 43807175) has the molecular formula C15H16O4S2 and a molecular weight of 324.42 g/mol. Its IUPAC name is 4-(3-methylsulfonylphenoxy)-1-thiophen-2-ylbutan-1-one.
| Compound Name | 4-(3-methylsulfonylphenoxy)-1-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 43807175 |
| Molecular Formula | C15H16O4S2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 4-(3-methylsulfonylphenoxy)-1-thiophen-2-ylbutan-1-one |
| SMILES | CS(=O)(=O)c1cccc(OCCCC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C15H16O4S2/c1-21(17,18)13-6-2-5-12(11-13)19-9-3-7-14(16)15-8-4-10-20-15/h2,4-6,8,10-11H,3,7,9H2,1H3 |
| InChIKey | PYZWQVMXDONVGN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|