C13H20O2 — CID 43509991
3-(3-methyl-4-propan-2-ylphenoxy)propan-1-ol (PubChem CID 43509991) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 3-(3-methyl-4-propan-2-ylphenoxy)propan-1-ol.
| Compound Name | 3-(3-methyl-4-propan-2-ylphenoxy)propan-1-ol |
|---|---|
| PubChem CID | 43509991 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 3-(3-methyl-4-propan-2-ylphenoxy)propan-1-ol |
| SMILES | Cc1cc(OCCCO)ccc1C(C)C |
| InChI | InChI=1S/C13H20O2/c1-10(2)13-6-5-12(9-11(13)3)15-8-4-7-14/h5-6,9-10,14H,4,7-8H2,1-3H3 |
| InChIKey | HMAXAAIXZMWIJG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|