C13H20N2OS — CID 36521491
2-(3-methyl-4-propan-2-ylphenoxy)ethyl carbamimidothioate (PubChem CID 36521491) has the molecular formula C13H20N2OS and a molecular weight of 252.38 g/mol. Its IUPAC name is 2-(3-methyl-4-propan-2-ylphenoxy)ethyl carbamimidothioate.
| Compound Name | 2-(3-methyl-4-propan-2-ylphenoxy)ethyl carbamimidothioate |
|---|---|
| PubChem CID | 36521491 |
| Molecular Formula | C13H20N2OS |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 2-(3-methyl-4-propan-2-ylphenoxy)ethyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCCOc1ccc(C(C)C)c(C)c1 |
| InChI | InChI=1S/C13H20N2OS/c1-9(2)12-5-4-11(8-10(12)3)16-6-7-17-13(14)15/h4-5,8-9H,6-7H2,1-3H3,(H3,14,15) |
| InChIKey | ZNLADLGCKSNQME-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|