C22H25NO5 — CID 17128736
cyclohexyl 4-[[2-(4-methoxyphenoxy)acetyl]amino]benzoate (PubChem CID 17128736) has the molecular formula C22H25NO5 and a molecular weight of 383.44 g/mol. Its IUPAC name is cyclohexyl 4-[[2-(4-methoxyphenoxy)acetyl]amino]benzoate.
| Compound Name | cyclohexyl 4-[[2-(4-methoxyphenoxy)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 17128736 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | cyclohexyl 4-[[2-(4-methoxyphenoxy)acetyl]amino]benzoate |
| SMILES | COc1ccc(OCC(=O)Nc2ccc(C(=O)OC3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C22H25NO5/c1-26-18-11-13-19(14-12-18)27-15-21(24)23-17-9-7-16(8-10-17)22(25)28-20-5-3-2-4-6-20/h7-14,20H,2-6,15H2,1H3,(H,23,24) |
| InChIKey | LGHMWZFEWCFHHR-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |