C21H22ClN3O4 — CID 121062397
4-[[2-(4-chlorophenoxy)acetyl]amino]-N-[2-(cyclopropanecarbonylamino)ethyl]benzamide (PubChem CID 121062397) has the molecular formula C21H22ClN3O4 and a molecular weight of 415.88 g/mol. Its IUPAC name is 4-[[2-(4-chlorophenoxy)acetyl]amino]-N-[2-(cyclopropanecarbonylamino)ethyl]benzamide.
| Compound Name | 4-[[2-(4-chlorophenoxy)acetyl]amino]-N-[2-(cyclopropanecarbonylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 121062397 |
| Molecular Formula | C21H22ClN3O4 |
| Molecular Weight | 415.88 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 4-[[2-(4-chlorophenoxy)acetyl]amino]-N-[2-(cyclopropanecarbonylamino)ethyl]benzamide |
| SMILES | O=C(COc1ccc(Cl)cc1)Nc1ccc(C(=O)NCCNC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C21H22ClN3O4/c22-16-5-9-18(10-6-16)29-13-19(26)25-17-7-3-15(4-8-17)21(28)24-12-11-23-20(27)14-1-2-14/h3-10,14H,1-2,11-13H2,(H,23,27)(H,24,28)(H,25,26) |
| InChIKey | GBBBZQGUGXPBPZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.88 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|