C21H22FN3O4 — CID 121062403
N-[2-(cyclopropanecarbonylamino)ethyl]-4-[[2-(2-fluorophenoxy)acetyl]amino]benzamide (PubChem CID 121062403) has the molecular formula C21H22FN3O4 and a molecular weight of 399.42 g/mol. Its IUPAC name is N-[2-(cyclopropanecarbonylamino)ethyl]-4-[[2-(2-fluorophenoxy)acetyl]amino]benzamide.
| Compound Name | N-[2-(cyclopropanecarbonylamino)ethyl]-4-[[2-(2-fluorophenoxy)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 121062403 |
| Molecular Formula | C21H22FN3O4 |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | N-[2-(cyclopropanecarbonylamino)ethyl]-4-[[2-(2-fluorophenoxy)acetyl]amino]benzamide |
| SMILES | O=C(COc1ccccc1F)Nc1ccc(C(=O)NCCNC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C21H22FN3O4/c22-17-3-1-2-4-18(17)29-13-19(26)25-16-9-7-15(8-10-16)21(28)24-12-11-23-20(27)14-5-6-14/h1-4,7-10,14H,5-6,11-13H2,(H,23,27)(H,24,28)(H,25,26) |
| InChIKey | LJXOYLZLIYUOCZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|