C23H27N3O5 — CID 121062396
N-[2-(cyclopropanecarbonylamino)ethyl]-4-[[2-(3,4-dimethoxyphenyl)acetyl]amino]benzamide (PubChem CID 121062396) has the molecular formula C23H27N3O5 and a molecular weight of 425.49 g/mol. Its IUPAC name is N-[2-(cyclopropanecarbonylamino)ethyl]-4-[[2-(3,4-dimethoxyphenyl)acetyl]amino]benzamide.
| Compound Name | N-[2-(cyclopropanecarbonylamino)ethyl]-4-[[2-(3,4-dimethoxyphenyl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 121062396 |
| Molecular Formula | C23H27N3O5 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | N-[2-(cyclopropanecarbonylamino)ethyl]-4-[[2-(3,4-dimethoxyphenyl)acetyl]amino]benzamide |
| SMILES | COc1ccc(CC(=O)Nc2ccc(C(=O)NCCNC(=O)C3CC3)cc2)cc1OC |
| InChI | InChI=1S/C23H27N3O5/c1-30-19-10-3-15(13-20(19)31-2)14-21(27)26-18-8-6-17(7-9-18)23(29)25-12-11-24-22(28)16-4-5-16/h3,6-10,13,16H,4-5,11-12,14H2,1-2H3,(H,24,28)(H,25,29)(H,26,27) |
| InChIKey | BJSDWTHCYANQLG-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|