C23H26ClN3O4 — CID 71656488
2-(3-chloro-4-methoxyphenyl)-N-[4-[(cyclohexanecarbonylamino)carbamoyl]phenyl]acetamide (PubChem CID 71656488) has the molecular formula C23H26ClN3O4 and a molecular weight of 443.93 g/mol. Its IUPAC name is 2-(3-chloro-4-methoxyphenyl)-N-[4-[(cyclohexanecarbonylamino)carbamoyl]phenyl]acetamide.
| Compound Name | 2-(3-chloro-4-methoxyphenyl)-N-[4-[(cyclohexanecarbonylamino)carbamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 71656488 |
| Molecular Formula | C23H26ClN3O4 |
| Molecular Weight | 443.93 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 2-(3-chloro-4-methoxyphenyl)-N-[4-[(cyclohexanecarbonylamino)carbamoyl]phenyl]acetamide |
| SMILES | COc1ccc(CC(=O)Nc2ccc(C(=O)NNC(=O)C3CCCCC3)cc2)cc1Cl |
| InChI | InChI=1S/C23H26ClN3O4/c1-31-20-12-7-15(13-19(20)24)14-21(28)25-18-10-8-17(9-11-18)23(30)27-26-22(29)16-5-3-2-4-6-16/h7-13,16H,2-6,14H2,1H3,(H,25,28)(H,26,29)(H,27,30) |
| InChIKey | AZLMTRKYVSQDCY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.93 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|