C25H28F3N3O4 — CID 55805957
N-[2-(cyclohexanecarbonylamino)ethyl]-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]benzamide (PubChem CID 55805957) has the molecular formula C25H28F3N3O4 and a molecular weight of 491.51 g/mol. Its IUPAC name is N-[2-(cyclohexanecarbonylamino)ethyl]-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]benzamide.
| Compound Name | N-[2-(cyclohexanecarbonylamino)ethyl]-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]benzamide |
|---|---|
| PubChem CID | 55805957 |
| Molecular Formula | C25H28F3N3O4 |
| Molecular Weight | 491.51 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | N-[2-(cyclohexanecarbonylamino)ethyl]-4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]benzamide |
| SMILES | O=C(COc1ccc(C(=O)NCCNC(=O)C2CCCCC2)cc1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H28F3N3O4/c26-25(27,28)19-7-4-8-20(15-19)31-22(32)16-35-21-11-9-18(10-12-21)24(34)30-14-13-29-23(33)17-5-2-1-3-6-17/h4,7-12,15,17H,1-3,5-6,13-14,16H2,(H,29,33)(H,30,34)(H,31,32) |
| InChIKey | ALOSHAPXCUWBES-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|