C23H26ClN3O5 — CID 121062689
N-[2-[[4-[[2-(4-chloro-3-methylphenoxy)acetyl]amino]benzoyl]amino]ethyl]oxolane-2-carboxamide (PubChem CID 121062689) has the molecular formula C23H26ClN3O5 and a molecular weight of 459.93 g/mol. Its IUPAC name is N-[2-[[4-[[2-(4-chloro-3-methylphenoxy)acetyl]amino]benzoyl]amino]ethyl]oxolane-2-carboxamide.
| Compound Name | N-[2-[[4-[[2-(4-chloro-3-methylphenoxy)acetyl]amino]benzoyl]amino]ethyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 121062689 |
| Molecular Formula | C23H26ClN3O5 |
| Molecular Weight | 459.93 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | N-[2-[[4-[[2-(4-chloro-3-methylphenoxy)acetyl]amino]benzoyl]amino]ethyl]oxolane-2-carboxamide |
| SMILES | Cc1cc(OCC(=O)Nc2ccc(C(=O)NCCNC(=O)C3CCCO3)cc2)ccc1Cl |
| InChI | InChI=1S/C23H26ClN3O5/c1-15-13-18(8-9-19(15)24)32-14-21(28)27-17-6-4-16(5-7-17)22(29)25-10-11-26-23(30)20-3-2-12-31-20/h4-9,13,20H,2-3,10-12,14H2,1H3,(H,25,29)(H,26,30)(H,27,28) |
| InChIKey | HCIFXIPTOUALGF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.93 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|