C14H19NO4 — CID 93441465
(2S)-N-[4-ethoxy-3-(hydroxymethyl)phenyl]oxolane-2-carboxamide (PubChem CID 93441465) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is (2S)-N-[4-ethoxy-3-(hydroxymethyl)phenyl]oxolane-2-carboxamide.
| Compound Name | (2S)-N-[4-ethoxy-3-(hydroxymethyl)phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 93441465 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | (2S)-N-[4-ethoxy-3-(hydroxymethyl)phenyl]oxolane-2-carboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@@H]2CCCO2)cc1CO |
| InChI | InChI=1S/C14H19NO4/c1-2-18-12-6-5-11(8-10(12)9-16)15-14(17)13-4-3-7-19-13/h5-6,8,13,16H,2-4,7,9H2,1H3,(H,15,17)/t13-/m0/s1 |
| InChIKey | RGZNNJGVFVKKQM-ZDUSSCGKSA-N |
| XLogP | 1.70 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |