C25H31N3O7 — CID 46642904
N-[3-[[(3,4,5-triethoxybenzoyl)amino]carbamoyl]phenyl]oxolane-2-carboxamide (PubChem CID 46642904) has the molecular formula C25H31N3O7 and a molecular weight of 485.54 g/mol. Its IUPAC name is N-[3-[[(3,4,5-triethoxybenzoyl)amino]carbamoyl]phenyl]oxolane-2-carboxamide.
| Compound Name | N-[3-[[(3,4,5-triethoxybenzoyl)amino]carbamoyl]phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 46642904 |
| Molecular Formula | C25H31N3O7 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | N-[3-[[(3,4,5-triethoxybenzoyl)amino]carbamoyl]phenyl]oxolane-2-carboxamide |
| SMILES | CCOc1cc(C(=O)NNC(=O)c2cccc(NC(=O)C3CCCO3)c2)cc(OCC)c1OCC |
| InChI | InChI=1S/C25H31N3O7/c1-4-32-20-14-17(15-21(33-5-2)22(20)34-6-3)24(30)28-27-23(29)16-9-7-10-18(13-16)26-25(31)19-11-8-12-35-19/h7,9-10,13-15,19H,4-6,8,11-12H2,1-3H3,(H,26,31)(H,27,29)(H,28,30) |
| InChIKey | RFMDRWCBVJTAFI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|