C14H17NO4 — CID 2169884
ethyl 3-[[(2R)-oxolane-2-carbonyl]amino]benzoate (PubChem CID 2169884) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is ethyl 3-[[(2R)-oxolane-2-carbonyl]amino]benzoate.
| Compound Name | ethyl 3-[[(2R)-oxolane-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 2169884 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | ethyl 3-[[(2R)-oxolane-2-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)[C@H]2CCCO2)c1 |
| InChI | InChI=1S/C14H17NO4/c1-2-18-14(17)10-5-3-6-11(9-10)15-13(16)12-7-4-8-19-12/h3,5-6,9,12H,2,4,7-8H2,1H3,(H,15,16)/t12-/m1/s1 |
| InChIKey | LJNJGKLSDYVJRF-GFCCVEGCSA-N |
| XLogP | 1.98 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |