C19H26N2O4 — CID 94489977
(2R)-N-[3-[ethyl-[[(2R)-oxolan-2-yl]methyl]carbamoyl]phenyl]oxolane-2-carboxamide (PubChem CID 94489977) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is (2R)-N-[3-[ethyl-[[(2R)-oxolan-2-yl]methyl]carbamoyl]phenyl]oxolane-2-carboxamide.
| Compound Name | (2R)-N-[3-[ethyl-[[(2R)-oxolan-2-yl]methyl]carbamoyl]phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 94489977 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | (2R)-N-[3-[ethyl-[[(2R)-oxolan-2-yl]methyl]carbamoyl]phenyl]oxolane-2-carboxamide |
| SMILES | CCN(C[C@H]1CCCO1)C(=O)c1cccc(NC(=O)[C@H]2CCCO2)c1 |
| InChI | InChI=1S/C19H26N2O4/c1-2-21(13-16-8-4-10-24-16)19(23)14-6-3-7-15(12-14)20-18(22)17-9-5-11-25-17/h3,6-7,12,16-17H,2,4-5,8-11,13H2,1H3,(H,20,22)/t16-,17-/m1/s1 |
| InChIKey | ODFMGSVRUUYRKR-IAGOWNOFSA-N |
| XLogP | 2.45 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |