C20H22N2O3 — CID 46548651
N-[3-[ethyl(phenyl)carbamoyl]phenyl]oxolane-2-carboxamide (PubChem CID 46548651) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is N-[3-[ethyl(phenyl)carbamoyl]phenyl]oxolane-2-carboxamide.
| Compound Name | N-[3-[ethyl(phenyl)carbamoyl]phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 46548651 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | N-[3-[ethyl(phenyl)carbamoyl]phenyl]oxolane-2-carboxamide |
| SMILES | CCN(C(=O)c1cccc(NC(=O)C2CCCO2)c1)c1ccccc1 |
| InChI | InChI=1S/C20H22N2O3/c1-2-22(17-10-4-3-5-11-17)20(24)15-8-6-9-16(14-15)21-19(23)18-12-7-13-25-18/h3-6,8-11,14,18H,2,7,12-13H2,1H3,(H,21,23) |
| InChIKey | LUBLSYPINFCDCO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |