C14H18N2O4 — CID 38396649
(2R)-N-[3-[(2-methoxyacetyl)amino]phenyl]oxolane-2-carboxamide (PubChem CID 38396649) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is (2R)-N-[3-[(2-methoxyacetyl)amino]phenyl]oxolane-2-carboxamide.
| Compound Name | (2R)-N-[3-[(2-methoxyacetyl)amino]phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 38396649 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (2R)-N-[3-[(2-methoxyacetyl)amino]phenyl]oxolane-2-carboxamide |
| SMILES | COCC(=O)Nc1cccc(NC(=O)[C@H]2CCCO2)c1 |
| InChI | InChI=1S/C14H18N2O4/c1-19-9-13(17)15-10-4-2-5-11(8-10)16-14(18)12-6-3-7-20-12/h2,4-5,8,12H,3,6-7,9H2,1H3,(H,15,17)(H,16,18)/t12-/m1/s1 |
| InChIKey | OVXGXCZLBIBBQM-GFCCVEGCSA-N |
| XLogP | 1.39 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |