C15H21NO4 — CID 81329971
N-[4-ethoxy-3-(hydroxymethyl)phenyl]-5-methyloxolane-2-carboxamide (PubChem CID 81329971) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is N-[4-ethoxy-3-(hydroxymethyl)phenyl]-5-methyloxolane-2-carboxamide.
| Compound Name | N-[4-ethoxy-3-(hydroxymethyl)phenyl]-5-methyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 81329971 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | N-[4-ethoxy-3-(hydroxymethyl)phenyl]-5-methyloxolane-2-carboxamide |
| SMILES | CCOc1ccc(NC(=O)C2CCC(C)O2)cc1CO |
| InChI | InChI=1S/C15H21NO4/c1-3-19-13-7-5-12(8-11(13)9-17)16-15(18)14-6-4-10(2)20-14/h5,7-8,10,14,17H,3-4,6,9H2,1-2H3,(H,16,18) |
| InChIKey | YBSNTUYXZMSOMM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |