C28H27N3O4 — CID 121062466
N-[4-[2-(cyclopropanecarbonylamino)ethylcarbamoyl]phenyl]-2-(4-methylbenzoyl)benzamide (PubChem CID 121062466) has the molecular formula C28H27N3O4 and a molecular weight of 469.54 g/mol. Its IUPAC name is N-[4-[2-(cyclopropanecarbonylamino)ethylcarbamoyl]phenyl]-2-(4-methylbenzoyl)benzamide.
| Compound Name | N-[4-[2-(cyclopropanecarbonylamino)ethylcarbamoyl]phenyl]-2-(4-methylbenzoyl)benzamide |
|---|---|
| PubChem CID | 121062466 |
| Molecular Formula | C28H27N3O4 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | N-[4-[2-(cyclopropanecarbonylamino)ethylcarbamoyl]phenyl]-2-(4-methylbenzoyl)benzamide |
| SMILES | Cc1ccc(C(=O)c2ccccc2C(=O)Nc2ccc(C(=O)NCCNC(=O)C3CC3)cc2)cc1 |
| InChI | InChI=1S/C28H27N3O4/c1-18-6-8-19(9-7-18)25(32)23-4-2-3-5-24(23)28(35)31-22-14-12-21(13-15-22)27(34)30-17-16-29-26(33)20-10-11-20/h2-9,12-15,20H,10-11,16-17H2,1H3,(H,29,33)(H,30,34)(H,31,35) |
| InChIKey | STCVTYDSRXBGLN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|