C23H21N3O5 — CID 121062400
N-[4-[2-(cyclopropanecarbonylamino)ethylcarbamoyl]phenyl]-2-oxochromene-3-carboxamide (PubChem CID 121062400) has the molecular formula C23H21N3O5 and a molecular weight of 419.44 g/mol. Its IUPAC name is N-[4-[2-(cyclopropanecarbonylamino)ethylcarbamoyl]phenyl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[4-[2-(cyclopropanecarbonylamino)ethylcarbamoyl]phenyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 121062400 |
| Molecular Formula | C23H21N3O5 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | N-[4-[2-(cyclopropanecarbonylamino)ethylcarbamoyl]phenyl]-2-oxochromene-3-carboxamide |
| SMILES | O=C(NCCNC(=O)C1CC1)c1ccc(NC(=O)c2cc3ccccc3oc2=O)cc1 |
| InChI | InChI=1S/C23H21N3O5/c27-20(14-5-6-14)24-11-12-25-21(28)15-7-9-17(10-8-15)26-22(29)18-13-16-3-1-2-4-19(16)31-23(18)30/h1-4,7-10,13-14H,5-6,11-12H2,(H,24,27)(H,25,28)(H,26,29) |
| InChIKey | HBVUTNCZPJJXAU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 117.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|