C19H27N3O3 — CID 121062485
N-[2-(cyclopropanecarbonylamino)ethyl]-4-(2-ethylbutanoylamino)benzamide (PubChem CID 121062485) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is N-[2-(cyclopropanecarbonylamino)ethyl]-4-(2-ethylbutanoylamino)benzamide.
| Compound Name | N-[2-(cyclopropanecarbonylamino)ethyl]-4-(2-ethylbutanoylamino)benzamide |
|---|---|
| PubChem CID | 121062485 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | N-[2-(cyclopropanecarbonylamino)ethyl]-4-(2-ethylbutanoylamino)benzamide |
| SMILES | CCC(CC)C(=O)Nc1ccc(C(=O)NCCNC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C19H27N3O3/c1-3-13(4-2)19(25)22-16-9-7-15(8-10-16)18(24)21-12-11-20-17(23)14-5-6-14/h7-10,13-14H,3-6,11-12H2,1-2H3,(H,20,23)(H,21,24)(H,22,25) |
| InChIKey | WGENHZLPZFAHJL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|