C20H20Cl2N4O3 — CID 121062566
N-[2-(cyclopropanecarbonylamino)ethyl]-4-[(3,4-dichlorophenyl)carbamoylamino]benzamide (PubChem CID 121062566) has the molecular formula C20H20Cl2N4O3 and a molecular weight of 435.31 g/mol. Its IUPAC name is N-[2-(cyclopropanecarbonylamino)ethyl]-4-[(3,4-dichlorophenyl)carbamoylamino]benzamide.
| Compound Name | N-[2-(cyclopropanecarbonylamino)ethyl]-4-[(3,4-dichlorophenyl)carbamoylamino]benzamide |
|---|---|
| PubChem CID | 121062566 |
| Molecular Formula | C20H20Cl2N4O3 |
| Molecular Weight | 435.31 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | N-[2-(cyclopropanecarbonylamino)ethyl]-4-[(3,4-dichlorophenyl)carbamoylamino]benzamide |
| SMILES | O=C(Nc1ccc(C(=O)NCCNC(=O)C2CC2)cc1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H20Cl2N4O3/c21-16-8-7-15(11-17(16)22)26-20(29)25-14-5-3-13(4-6-14)19(28)24-10-9-23-18(27)12-1-2-12/h3-8,11-12H,1-2,9-10H2,(H,23,27)(H,24,28)(H2,25,26,29) |
| InChIKey | RJDQTLLSFOWKNB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.31 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|