C20H19ClN4O5 — CID 121062477
2-chloro-N-[4-[2-(cyclopropanecarbonylamino)ethylcarbamoyl]phenyl]-5-nitrobenzamide (PubChem CID 121062477) has the molecular formula C20H19ClN4O5 and a molecular weight of 430.85 g/mol. Its IUPAC name is 2-chloro-N-[4-[2-(cyclopropanecarbonylamino)ethylcarbamoyl]phenyl]-5-nitrobenzamide.
| Compound Name | 2-chloro-N-[4-[2-(cyclopropanecarbonylamino)ethylcarbamoyl]phenyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 121062477 |
| Molecular Formula | C20H19ClN4O5 |
| Molecular Weight | 430.85 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 2-chloro-N-[4-[2-(cyclopropanecarbonylamino)ethylcarbamoyl]phenyl]-5-nitrobenzamide |
| SMILES | O=C(NCCNC(=O)C1CC1)c1ccc(NC(=O)c2cc([N+](=O)[O-])ccc2Cl)cc1 |
| InChI | InChI=1S/C20H19ClN4O5/c21-17-8-7-15(25(29)30)11-16(17)20(28)24-14-5-3-13(4-6-14)19(27)23-10-9-22-18(26)12-1-2-12/h3-8,11-12H,1-2,9-10H2,(H,22,26)(H,23,27)(H,24,28) |
| InChIKey | XICDAKWZYNBZCT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.85 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|