C22H18ClN3O5 — CID 139950405
N-[2-(4-benzamidophenoxy)ethyl]-2-chloro-5-nitrobenzamide (PubChem CID 139950405) has the molecular formula C22H18ClN3O5 and a molecular weight of 439.86 g/mol. Its IUPAC name is N-[2-(4-benzamidophenoxy)ethyl]-2-chloro-5-nitrobenzamide.
| Compound Name | N-[2-(4-benzamidophenoxy)ethyl]-2-chloro-5-nitrobenzamide |
|---|---|
| PubChem CID | 139950405 |
| Molecular Formula | C22H18ClN3O5 |
| Molecular Weight | 439.86 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | N-[2-(4-benzamidophenoxy)ethyl]-2-chloro-5-nitrobenzamide |
| SMILES | O=C(Nc1ccc(OCCNC(=O)c2cc([N+](=O)[O-])ccc2Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H18ClN3O5/c23-20-11-8-17(26(29)30)14-19(20)22(28)24-12-13-31-18-9-6-16(7-10-18)25-21(27)15-4-2-1-3-5-15/h1-11,14H,12-13H2,(H,24,28)(H,25,27) |
| InChIKey | NLSVAVFSQBZRQO-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.86 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|