C20H22ClN3O6 — CID 139950398
tert-butyl N-[3-[2-[(2-chloro-5-nitrobenzoyl)amino]ethoxy]phenyl]carbamate (PubChem CID 139950398) has the molecular formula C20H22ClN3O6 and a molecular weight of 435.86 g/mol. Its IUPAC name is tert-butyl N-[3-[2-[(2-chloro-5-nitrobenzoyl)amino]ethoxy]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[2-[(2-chloro-5-nitrobenzoyl)amino]ethoxy]phenyl]carbamate |
|---|---|
| PubChem CID | 139950398 |
| Molecular Formula | C20H22ClN3O6 |
| Molecular Weight | 435.86 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | tert-butyl N-[3-[2-[(2-chloro-5-nitrobenzoyl)amino]ethoxy]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(OCCNC(=O)c2cc([N+](=O)[O-])ccc2Cl)c1 |
| InChI | InChI=1S/C20H22ClN3O6/c1-20(2,3)30-19(26)23-13-5-4-6-15(11-13)29-10-9-22-18(25)16-12-14(24(27)28)7-8-17(16)21/h4-8,11-12H,9-10H2,1-3H3,(H,22,25)(H,23,26) |
| InChIKey | AMEAIHZGYQHESZ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.86 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|