C21H25ClN4O5 — CID 139962956
tert-butyl N-[3-[4-[(2-chloro-5-nitrobenzoyl)amino]anilino]propyl]carbamate (PubChem CID 139962956) has the molecular formula C21H25ClN4O5 and a molecular weight of 448.91 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[(2-chloro-5-nitrobenzoyl)amino]anilino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[(2-chloro-5-nitrobenzoyl)amino]anilino]propyl]carbamate |
|---|---|
| PubChem CID | 139962956 |
| Molecular Formula | C21H25ClN4O5 |
| Molecular Weight | 448.91 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | tert-butyl N-[3-[4-[(2-chloro-5-nitrobenzoyl)amino]anilino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNc1ccc(NC(=O)c2cc([N+](=O)[O-])ccc2Cl)cc1 |
| InChI | InChI=1S/C21H25ClN4O5/c1-21(2,3)31-20(28)24-12-4-11-23-14-5-7-15(8-6-14)25-19(27)17-13-16(26(29)30)9-10-18(17)22/h5-10,13,23H,4,11-12H2,1-3H3,(H,24,28)(H,25,27) |
| InChIKey | SFSIFZXNYXHNCN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.91 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|