C15H18F3N3O2 — CID 119726163
4-[(3-aminocyclopentanecarbonyl)amino]-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 119726163) has the molecular formula C15H18F3N3O2 and a molecular weight of 329.32 g/mol. Its IUPAC name is 4-[(3-aminocyclopentanecarbonyl)amino]-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-[(3-aminocyclopentanecarbonyl)amino]-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 119726163 |
| Molecular Formula | C15H18F3N3O2 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 4-[(3-aminocyclopentanecarbonyl)amino]-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | NC1CCC(C(=O)Nc2ccc(C(=O)NCC(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C15H18F3N3O2/c16-15(17,18)8-20-13(22)9-2-5-12(6-3-9)21-14(23)10-1-4-11(19)7-10/h2-3,5-6,10-11H,1,4,7-8,19H2,(H,20,22)(H,21,23) |
| InChIKey | IWGCLIUUSWITEA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |