C18H26ClN3O4 — CID 119701343
methyl 3-[[4-[(3-aminocyclohexanecarbonyl)amino]benzoyl]amino]propanoate;hydrochloride (PubChem CID 119701343) has the molecular formula C18H26ClN3O4 and a molecular weight of 383.88 g/mol. Its IUPAC name is methyl 3-[[4-[(3-aminocyclohexanecarbonyl)amino]benzoyl]amino]propanoate;hydrochloride.
| Compound Name | methyl 3-[[4-[(3-aminocyclohexanecarbonyl)amino]benzoyl]amino]propanoate;hydrochloride |
|---|---|
| PubChem CID | 119701343 |
| Molecular Formula | C18H26ClN3O4 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | methyl 3-[[4-[(3-aminocyclohexanecarbonyl)amino]benzoyl]amino]propanoate;hydrochloride |
| SMILES | COC(=O)CCNC(=O)c1ccc(NC(=O)C2CCCC(N)C2)cc1.Cl |
| InChI | InChI=1S/C18H25N3O4.ClH/c1-25-16(22)9-10-20-17(23)12-5-7-15(8-6-12)21-18(24)13-3-2-4-14(19)11-13;/h5-8,13-14H,2-4,9-11,19H2,1H3,(H,20,23)(H,21,24);1H |
| InChIKey | OHOQZFIIQILQPZ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |