C18H26N2O4 — CID 119784190
methyl 4-[4-[(3-aminocyclohexanecarbonyl)amino]phenoxy]butanoate (PubChem CID 119784190) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is methyl 4-[4-[(3-aminocyclohexanecarbonyl)amino]phenoxy]butanoate.
| Compound Name | methyl 4-[4-[(3-aminocyclohexanecarbonyl)amino]phenoxy]butanoate |
|---|---|
| PubChem CID | 119784190 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | methyl 4-[4-[(3-aminocyclohexanecarbonyl)amino]phenoxy]butanoate |
| SMILES | COC(=O)CCCOc1ccc(NC(=O)C2CCCC(N)C2)cc1 |
| InChI | InChI=1S/C18H26N2O4/c1-23-17(21)6-3-11-24-16-9-7-15(8-10-16)20-18(22)13-4-2-5-14(19)12-13/h7-10,13-14H,2-6,11-12,19H2,1H3,(H,20,22) |
| InChIKey | SQSFDBFDDDAXJT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|