C14H17F6N3O4S — CID 89185244
N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]-5-(2,2,2-trifluoroethylsulfonylamino)pentanamide (PubChem CID 89185244) has the molecular formula C14H17F6N3O4S and a molecular weight of 437.36 g/mol. Its IUPAC name is N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]-5-(2,2,2-trifluoroethylsulfonylamino)pentanamide.
| Compound Name | N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]-5-(2,2,2-trifluoroethylsulfonylamino)pentanamide |
|---|---|
| PubChem CID | 89185244 |
| Molecular Formula | C14H17F6N3O4S |
| Molecular Weight | 437.36 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | N-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]-5-(2,2,2-trifluoroethylsulfonylamino)pentanamide |
| SMILES | O=C(CCCCNS(=O)(=O)CC(F)(F)F)Nc1ccc(OCC(F)(F)F)nc1 |
| InChI | InChI=1S/C14H17F6N3O4S/c15-13(16,17)8-27-12-5-4-10(7-21-12)23-11(24)3-1-2-6-22-28(25,26)9-14(18,19)20/h4-5,7,22H,1-3,6,8-9H2,(H,23,24) |
| InChIKey | WWWDIEPWDMJLHW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|